C25H19FN4O4S2 — CID 118376084
N-[[5-[(3,5-dioxothiolan-2-yl)methyl]-1,3,4-oxadiazol-2-yl]-(4-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]cyclopropanecarboxamide (PubChem CID 118376084) has the molecular formula C25H19FN4O4S2 and a molecular weight of 522.58 g/mol. Its IUPAC name is N-[[5-[(3,5-dioxothiolan-2-yl)methyl]-1,3,4-oxadiazol-2-yl]-(4-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]cyclopropanecarboxamide.
| Compound Name | N-[[5-[(3,5-dioxothiolan-2-yl)methyl]-1,3,4-oxadiazol-2-yl]-(4-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 118376084 |
| Molecular Formula | C25H19FN4O4S2 |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | N-[[5-[(3,5-dioxothiolan-2-yl)methyl]-1,3,4-oxadiazol-2-yl]-(4-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]cyclopropanecarboxamide |
| SMILES | O=C1CC(=O)C(Cc2nnc(C(NC(=O)C3CC3)c3nc4c(F)cc(-c5ccccc5)cc4s3)o2)S1 |
| InChI | InChI=1S/C25H19FN4O4S2/c26-15-8-14(12-4-2-1-3-5-12)9-18-21(15)28-25(36-18)22(27-23(33)13-6-7-13)24-30-29-19(34-24)11-17-16(31)10-20(32)35-17/h1-5,8-9,13,17,22H,6-7,10-11H2,(H,27,33) |
| InChIKey | XHDWSOYPGFFPFS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|