C27H19FN4O5S3 — CID 90057551
5-[[5-[benzylsulfonyl-(7-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazol-2-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 90057551) has the molecular formula C27H19FN4O5S3 and a molecular weight of 594.67 g/mol. Its IUPAC name is 5-[[5-[benzylsulfonyl-(7-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazol-2-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[5-[benzylsulfonyl-(7-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazol-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 90057551 |
| Molecular Formula | C27H19FN4O5S3 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.05 |
| IUPAC Name | 5-[[5-[benzylsulfonyl-(7-fluoro-6-phenyl-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazol-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2nnc(C(c3nc4ccc(-c5ccccc5)c(F)c4s3)S(=O)(=O)Cc3ccccc3)o2)S1 |
| InChI | InChI=1S/C27H19FN4O5S3/c28-21-17(16-9-5-2-6-10-16)11-12-18-22(21)39-26(29-18)23(40(35,36)14-15-7-3-1-4-8-15)25-32-31-20(37-25)13-19-24(33)30-27(34)38-19/h1-12,19,23H,13-14H2,(H,30,33,34) |
| InChIKey | GCJPSTPGINJSHP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|