C16H25N3O4 — CID 123648143
2-(6-acetamidohexanoylamino)-3-(3,4-dihydropyridin-6-yl)propanoic acid (PubChem CID 123648143) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-(6-acetamidohexanoylamino)-3-(3,4-dihydropyridin-6-yl)propanoic acid.
| Compound Name | 2-(6-acetamidohexanoylamino)-3-(3,4-dihydropyridin-6-yl)propanoic acid |
|---|---|
| PubChem CID | 123648143 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 2-(6-acetamidohexanoylamino)-3-(3,4-dihydropyridin-6-yl)propanoic acid |
| SMILES | CC(=O)NCCCCCC(=O)NC(CC1=CCCC=N1)C(=O)O |
| InChI | InChI=1S/C16H25N3O4/c1-12(20)17-9-5-2-3-8-15(21)19-14(16(22)23)11-13-7-4-6-10-18-13/h7,10,14H,2-6,8-9,11H2,1H3,(H,17,20)(H,19,21)(H,22,23) |
| InChIKey | WANXJGJNWNUJFN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|