C31H40N5O4+ — CID 123648338
N-[2-methyl-3-oxo-3-[[1-oxo-4-phenyl-1-(quinolin-1-ium-3-ylamino)butan-2-yl]amino]propyl]-N',N'-dipropyloxamide (PubChem CID 123648338) has the molecular formula C31H40N5O4+ and a molecular weight of 546.69 g/mol. Its IUPAC name is N-[2-methyl-3-oxo-3-[[1-oxo-4-phenyl-1-(quinolin-1-ium-3-ylamino)butan-2-yl]amino]propyl]-N',N'-dipropyloxamide.
| Compound Name | N-[2-methyl-3-oxo-3-[[1-oxo-4-phenyl-1-(quinolin-1-ium-3-ylamino)butan-2-yl]amino]propyl]-N',N'-dipropyloxamide |
|---|---|
| PubChem CID | 123648338 |
| Molecular Formula | C31H40N5O4+ |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | N-[2-methyl-3-oxo-3-[[1-oxo-4-phenyl-1-(quinolin-1-ium-3-ylamino)butan-2-yl]amino]propyl]-N',N'-dipropyloxamide |
| SMILES | CCCN(CCC)C(=O)C(=O)NCC(C)C(=O)NC(CCc1ccccc1)C(=O)Nc1c[nH+]c2ccccc2c1 |
| InChI | InChI=1S/C31H39N5O4/c1-4-17-36(18-5-2)31(40)30(39)33-20-22(3)28(37)35-27(16-15-23-11-7-6-8-12-23)29(38)34-25-19-24-13-9-10-14-26(24)32-21-25/h6-14,19,21-22,27H,4-5,15-18,20H2,1-3H3,(H,33,39)(H,34,38)(H,35,37)/p+1 |
| InChIKey | INJOCLZHTMWNMW-UHFFFAOYSA-O |
| XLogP | 3.11 |
| TPSA | 121.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|