C30H38N2O3 — CID 123649494
N-[[3-[[(1R)-1-cyclohexylethyl]iminomethyl]-4-oxo-1-phenylcyclohexyl]methyl]-2-methoxybenzamide (PubChem CID 123649494) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-[[3-[[(1R)-1-cyclohexylethyl]iminomethyl]-4-oxo-1-phenylcyclohexyl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[3-[[(1R)-1-cyclohexylethyl]iminomethyl]-4-oxo-1-phenylcyclohexyl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 123649494 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | N-[[3-[[(1R)-1-cyclohexylethyl]iminomethyl]-4-oxo-1-phenylcyclohexyl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCC1(c2ccccc2)CCC(=O)C(/C=N/[C@H](C)C2CCCCC2)C1 |
| InChI | InChI=1S/C30H38N2O3/c1-22(23-11-5-3-6-12-23)31-20-24-19-30(18-17-27(24)33,25-13-7-4-8-14-25)21-32-29(34)26-15-9-10-16-28(26)35-2/h4,7-10,13-16,20,22-24H,3,5-6,11-12,17-19,21H2,1-2H3,(H,32,34)/b31-20+/t22-,24?,30?/m1/s1 |
| InChIKey | CISVQGDCMCQSSR-QJOQUTGASA-N |
| XLogP | 5.77 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|