C12H19N — CID 123651671
1-hepta-2,4,6-trien-3-ylpiperidine (PubChem CID 123651671) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 1-hepta-2,4,6-trien-3-ylpiperidine.
| Compound Name | 1-hepta-2,4,6-trien-3-ylpiperidine |
|---|---|
| PubChem CID | 123651671 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1-hepta-2,4,6-trien-3-ylpiperidine |
| SMILES | C=CC=CC(=CC)N1CCCCC1 |
| InChI | InChI=1S/C12H19N/c1-3-5-9-12(4-2)13-10-7-6-8-11-13/h3-5,9H,1,6-8,10-11H2,2H3 |
| InChIKey | KWELJFLCGQKBRG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|