About 6-trichlorosilylhexanoic acid
6-trichlorosilylhexanoic acid (PubChem CID 123653334) has the molecular formula C6H11Cl3O2Si
and a molecular weight of 249.60 g/mol. Its IUPAC name is 6-trichlorosilylhexanoic acid.
Molecular Properties
| Compound Name | 6-trichlorosilylhexanoic acid |
| PubChem CID | 123653334 |
| Molecular Formula | C6H11Cl3O2Si |
| Molecular Weight | 249.60 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 6-trichlorosilylhexanoic acid |
| SMILES | O=C(O)CCCCC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C6H11Cl3O2Si/c7-12(8,9)5-3-1-2-4-6(10)11/h1-5H2,(H,10,11) |
| InChIKey | FPUDPRLGFNEJRR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 6-trichlorosilylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-trichlorosilylhexanoic acid?
The IUPAC name of 6-trichlorosilylhexanoic acid (CID 123653334) is 6-trichlorosilylhexanoic acid.
What is the SMILES notation for 6-trichlorosilylhexanoic acid?
The canonical SMILES for 6-trichlorosilylhexanoic acid is O=C(O)CCCCC[Si](Cl)(Cl)Cl.
What is the InChIKey of 6-trichlorosilylhexanoic acid?
The InChIKey is FPUDPRLGFNEJRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11Cl3O2Si/c7-12(8,9)5-3-1-2-4-6(10)11/h1-5H2,(H,10,11).
What are the key properties of 6-trichlorosilylhexanoic acid?
6-trichlorosilylhexanoic acid has a molecular weight of 249.60 g/mol, XLogP of 3.29, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-trichlorosilylhexanoic acid is sourced from PubChem (CID 123653334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).