C15H13F2N3O3 — CID 123654940
1-[4-(difluoromethoxy)phenyl]-3-(3-methyliminopropanoyl)pyridazin-4-one (PubChem CID 123654940) has the molecular formula C15H13F2N3O3 and a molecular weight of 321.28 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-(3-methyliminopropanoyl)pyridazin-4-one.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-(3-methyliminopropanoyl)pyridazin-4-one |
|---|---|
| PubChem CID | 123654940 |
| Molecular Formula | C15H13F2N3O3 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-(3-methyliminopropanoyl)pyridazin-4-one |
| SMILES | C/N=C/CC(=O)c1nn(-c2ccc(OC(F)F)cc2)ccc1=O |
| InChI | InChI=1S/C15H13F2N3O3/c1-18-8-6-12(21)14-13(22)7-9-20(19-14)10-2-4-11(5-3-10)23-15(16)17/h2-5,7-9,15H,6H2,1H3/b18-8+ |
| InChIKey | PJBIZIGNBFWRHM-QGMBQPNBSA-N |
| XLogP | 2.11 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|