C20H16F2N4O2 — CID 123608934
1-[4-(difluoromethoxy)phenyl]-3-[C-(2-iminoethyl)-N-phenylcarbonimidoyl]pyridazin-4-one (PubChem CID 123608934) has the molecular formula C20H16F2N4O2 and a molecular weight of 382.37 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[C-(2-iminoethyl)-N-phenylcarbonimidoyl]pyridazin-4-one.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[C-(2-iminoethyl)-N-phenylcarbonimidoyl]pyridazin-4-one |
|---|---|
| PubChem CID | 123608934 |
| Molecular Formula | C20H16F2N4O2 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[C-(2-iminoethyl)-N-phenylcarbonimidoyl]pyridazin-4-one |
| SMILES | [H]/N=C/C/C(=N\c1ccccc1)c1nn(-c2ccc(OC(F)F)cc2)ccc1=O |
| InChI | InChI=1S/C20H16F2N4O2/c21-20(22)28-16-8-6-15(7-9-16)26-13-11-18(27)19(25-26)17(10-12-23)24-14-4-2-1-3-5-14/h1-9,11-13,20,23H,10H2/b23-12+,24-17+ |
| InChIKey | XAKNBCVWASVTJB-NACSPRHISA-N |
| XLogP | 3.99 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|