C13H22O2 — CID 123655290
4-ethyl-2-propan-2-yl-4a,5,6,8a-tetrahydro-4H-1,3-benzodioxine (PubChem CID 123655290) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-ethyl-2-propan-2-yl-4a,5,6,8a-tetrahydro-4H-1,3-benzodioxine.
| Compound Name | 4-ethyl-2-propan-2-yl-4a,5,6,8a-tetrahydro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 123655290 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 4-ethyl-2-propan-2-yl-4a,5,6,8a-tetrahydro-4H-1,3-benzodioxine |
| SMILES | CCC1OC(C(C)C)OC2C=CCCC21 |
| InChI | InChI=1S/C13H22O2/c1-4-11-10-7-5-6-8-12(10)15-13(14-11)9(2)3/h6,8-13H,4-5,7H2,1-3H3 |
| InChIKey | LNMPWGUKIYORIS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|