C9H13NO — CID 123657299
6-methyl-1,2,3,3a,4,7a-hexahydroindol-5-one (PubChem CID 123657299) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 6-methyl-1,2,3,3a,4,7a-hexahydroindol-5-one.
| Compound Name | 6-methyl-1,2,3,3a,4,7a-hexahydroindol-5-one |
|---|---|
| PubChem CID | 123657299 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 6-methyl-1,2,3,3a,4,7a-hexahydroindol-5-one |
| SMILES | CC1=CC2NCCC2CC1=O |
| InChI | InChI=1S/C9H13NO/c1-6-4-8-7(2-3-10-8)5-9(6)11/h4,7-8,10H,2-3,5H2,1H3 |
| InChIKey | PPQYXJMUEKHQKX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |