C9H14OS — CID 170072121
2,4-dimethyl-6-sulfanylcyclohept-2-en-1-one (PubChem CID 170072121) has the molecular formula C9H14OS and a molecular weight of 170.28 g/mol. Its IUPAC name is 2,4-dimethyl-6-sulfanylcyclohept-2-en-1-one.
| Compound Name | 2,4-dimethyl-6-sulfanylcyclohept-2-en-1-one |
|---|---|
| PubChem CID | 170072121 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2,4-dimethyl-6-sulfanylcyclohept-2-en-1-one |
| SMILES | CC1=CC(C)CC(S)CC1=O |
| InChI | InChI=1S/C9H14OS/c1-6-3-7(2)9(10)5-8(11)4-6/h3,6,8,11H,4-5H2,1-2H3 |
| InChIKey | JJTLRGQYYQXHDJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|