C21H23F3N6O2S — CID 123658545
amino-[3-[[4-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1,3-thiazol-2-yl]amino]-4-(trifluoromethoxy)phenyl]methanol (PubChem CID 123658545) has the molecular formula C21H23F3N6O2S and a molecular weight of 480.52 g/mol. Its IUPAC name is amino-[3-[[4-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1,3-thiazol-2-yl]amino]-4-(trifluoromethoxy)phenyl]methanol.
| Compound Name | amino-[3-[[4-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1,3-thiazol-2-yl]amino]-4-(trifluoromethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 123658545 |
| Molecular Formula | C21H23F3N6O2S |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | amino-[3-[[4-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]-1,3-thiazol-2-yl]amino]-4-(trifluoromethoxy)phenyl]methanol |
| SMILES | CN1CCN(c2cc(-c3csc(Nc4cc(C(N)O)ccc4OC(F)(F)F)n3)ccn2)CC1 |
| InChI | InChI=1S/C21H23F3N6O2S/c1-29-6-8-30(9-7-29)18-11-13(4-5-26-18)16-12-33-20(28-16)27-15-10-14(19(25)31)2-3-17(15)32-21(22,23)24/h2-5,10-12,19,31H,6-9,25H2,1H3,(H,27,28) |
| InChIKey | JQECBMXRORHYMH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|