C20H18N6O4S — CID 123658878
2-[[5-[3-[4-methyl-2-(methylamino)-1H-indol-5-yl]-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 123658878) has the molecular formula C20H18N6O4S and a molecular weight of 438.47 g/mol. Its IUPAC name is 2-[[5-[3-[4-methyl-2-(methylamino)-1H-indol-5-yl]-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[3-[4-methyl-2-(methylamino)-1H-indol-5-yl]-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 123658878 |
| Molecular Formula | C20H18N6O4S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-[[5-[3-[4-methyl-2-(methylamino)-1H-indol-5-yl]-5-nitrophenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | CNc1cc2c(C)c(-c3cc(-c4nc(SCC(=O)O)n[nH]4)cc([N+](=O)[O-])c3)ccc2[nH]1 |
| InChI | InChI=1S/C20H18N6O4S/c1-10-14(3-4-16-15(10)8-17(21-2)22-16)11-5-12(7-13(6-11)26(29)30)19-23-20(25-24-19)31-9-18(27)28/h3-8,21-22H,9H2,1-2H3,(H,27,28)(H,23,24,25) |
| InChIKey | UMWWTBURZWWRBS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 149.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|