C19H21F2N3 — CID 123659213
2-(2,6-difluorocyclohexa-1,3-dien-1-yl)-5-(4-methyl-3-pyridinyl)-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridine (PubChem CID 123659213) has the molecular formula C19H21F2N3 and a molecular weight of 329.39 g/mol. Its IUPAC name is 2-(2,6-difluorocyclohexa-1,3-dien-1-yl)-5-(4-methyl-3-pyridinyl)-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridine.
| Compound Name | 2-(2,6-difluorocyclohexa-1,3-dien-1-yl)-5-(4-methyl-3-pyridinyl)-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 123659213 |
| Molecular Formula | C19H21F2N3 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-(2,6-difluorocyclohexa-1,3-dien-1-yl)-5-(4-methyl-3-pyridinyl)-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridine |
| SMILES | Cc1ccncc1N1CCC2N=C(C3=C(F)C=CCC3F)CC2C1 |
| InChI | InChI=1S/C19H21F2N3/c1-12-5-7-22-10-18(12)24-8-6-16-13(11-24)9-17(23-16)19-14(20)3-2-4-15(19)21/h2-3,5,7,10,13,15-16H,4,6,8-9,11H2,1H3 |
| InChIKey | NHLBXJXGKZGUBI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |