C20H20F3N3 — CID 123591871
4-[2-(2,6-difluorophenyl)-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-2-fluoro-5-methylaniline (PubChem CID 123591871) has the molecular formula C20H20F3N3 and a molecular weight of 359.40 g/mol. Its IUPAC name is 4-[2-(2,6-difluorophenyl)-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-2-fluoro-5-methylaniline.
| Compound Name | 4-[2-(2,6-difluorophenyl)-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-2-fluoro-5-methylaniline |
|---|---|
| PubChem CID | 123591871 |
| Molecular Formula | C20H20F3N3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-[2-(2,6-difluorophenyl)-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-2-fluoro-5-methylaniline |
| SMILES | Cc1cc(N)c(F)cc1N1CCC2N=C(c3c(F)cccc3F)CC2C1 |
| InChI | InChI=1S/C20H20F3N3/c1-11-7-16(24)15(23)9-19(11)26-6-5-17-12(10-26)8-18(25-17)20-13(21)3-2-4-14(20)22/h2-4,7,9,12,17H,5-6,8,10,24H2,1H3 |
| InChIKey | BSEKYHZWQRWGAM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|