C23H26N2O5 — CID 123660243
4-methyl-2-[[4-[(2-phenylmethoxyacetyl)amino]benzoyl]amino]hex-4-enoic acid (PubChem CID 123660243) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-methyl-2-[[4-[(2-phenylmethoxyacetyl)amino]benzoyl]amino]hex-4-enoic acid.
| Compound Name | 4-methyl-2-[[4-[(2-phenylmethoxyacetyl)amino]benzoyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 123660243 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 4-methyl-2-[[4-[(2-phenylmethoxyacetyl)amino]benzoyl]amino]hex-4-enoic acid |
| SMILES | CC=C(C)CC(NC(=O)c1ccc(NC(=O)COCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C23H26N2O5/c1-3-16(2)13-20(23(28)29)25-22(27)18-9-11-19(12-10-18)24-21(26)15-30-14-17-7-5-4-6-8-17/h3-12,20H,13-15H2,1-2H3,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | VJBZNEHBAUUIMP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|