C20H13ClN4O3S2 — CID 123660316
1-[4-chloro-2-(isocyanomethoxy)phenyl]-N-(1,3-thiazol-2-yl)isoquinoline-6-sulfonamide (PubChem CID 123660316) has the molecular formula C20H13ClN4O3S2 and a molecular weight of 456.94 g/mol. Its IUPAC name is 1-[4-chloro-2-(isocyanomethoxy)phenyl]-N-(1,3-thiazol-2-yl)isoquinoline-6-sulfonamide.
| Compound Name | 1-[4-chloro-2-(isocyanomethoxy)phenyl]-N-(1,3-thiazol-2-yl)isoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 123660316 |
| Molecular Formula | C20H13ClN4O3S2 |
| Molecular Weight | 456.94 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | 1-[4-chloro-2-(isocyanomethoxy)phenyl]-N-(1,3-thiazol-2-yl)isoquinoline-6-sulfonamide |
| SMILES | [C-]#[N+]COc1cc(Cl)ccc1-c1nccc2cc(S(=O)(=O)Nc3nccs3)ccc12 |
| InChI | InChI=1S/C20H13ClN4O3S2/c1-22-12-28-18-11-14(21)2-4-17(18)19-16-5-3-15(10-13(16)6-7-23-19)30(26,27)25-20-24-8-9-29-20/h2-11H,12H2,(H,24,25) |
| InChIKey | XYUKBAXJKYKNPA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 85.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.94 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|