C22H20N4O2S2 — CID 86687511
1-(2-phenylpyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)isoquinoline-6-sulfonamide (PubChem CID 86687511) has the molecular formula C22H20N4O2S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-(2-phenylpyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)isoquinoline-6-sulfonamide.
| Compound Name | 1-(2-phenylpyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)isoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 86687511 |
| Molecular Formula | C22H20N4O2S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-(2-phenylpyrrolidin-1-yl)-N-(1,3-thiazol-2-yl)isoquinoline-6-sulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1ccc2c(N3CCCC3c3ccccc3)nccc2c1 |
| InChI | InChI=1S/C22H20N4O2S2/c27-30(28,25-22-24-12-14-29-22)18-8-9-19-17(15-18)10-11-23-21(19)26-13-4-7-20(26)16-5-2-1-3-6-16/h1-3,5-6,8-12,14-15,20H,4,7,13H2,(H,24,25) |
| InChIKey | YRONGUBVRZOOEW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |