C11H12Cl2O — CID 123660381
3-chloro-7-(chloromethyl)-2,2-dimethyl-3H-1-benzofuran (PubChem CID 123660381) has the molecular formula C11H12Cl2O and a molecular weight of 231.12 g/mol. Its IUPAC name is 3-chloro-7-(chloromethyl)-2,2-dimethyl-3H-1-benzofuran.
| Compound Name | 3-chloro-7-(chloromethyl)-2,2-dimethyl-3H-1-benzofuran |
|---|---|
| PubChem CID | 123660381 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 3-chloro-7-(chloromethyl)-2,2-dimethyl-3H-1-benzofuran |
| SMILES | CC1(C)Oc2c(CCl)cccc2C1Cl |
| InChI | InChI=1S/C11H12Cl2O/c1-11(2)10(13)8-5-3-4-7(6-12)9(8)14-11/h3-5,10H,6H2,1-2H3 |
| InChIKey | LFZYTDNIFBUSFW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|