C18H23N5O2 — CID 123663505
tert-butyl N-[4-[6-(diaminomethylideneamino)-2-methyl-3-pyridinyl]phenyl]carbamate (PubChem CID 123663505) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is tert-butyl N-[4-[6-(diaminomethylideneamino)-2-methyl-3-pyridinyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[6-(diaminomethylideneamino)-2-methyl-3-pyridinyl]phenyl]carbamate |
|---|---|
| PubChem CID | 123663505 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | tert-butyl N-[4-[6-(diaminomethylideneamino)-2-methyl-3-pyridinyl]phenyl]carbamate |
| SMILES | Cc1nc(N=C(N)N)ccc1-c1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H23N5O2/c1-11-14(9-10-15(21-11)23-16(19)20)12-5-7-13(8-6-12)22-17(24)25-18(2,3)4/h5-10H,1-4H3,(H,22,24)(H4,19,20,21,23) |
| InChIKey | JYMBOGLCOBWYBU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|