C10H30O3Si4 — CID 123669271
[butyl(methyl)silyl]oxy-bis[hydroxy(dimethyl)silyl]-methylsilane (PubChem CID 123669271) has the molecular formula C10H30O3Si4 and a molecular weight of 310.69 g/mol. Its IUPAC name is [butyl(methyl)silyl]oxy-bis[hydroxy(dimethyl)silyl]-methylsilane.
| Compound Name | [butyl(methyl)silyl]oxy-bis[hydroxy(dimethyl)silyl]-methylsilane |
|---|---|
| PubChem CID | 123669271 |
| Molecular Formula | C10H30O3Si4 |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | [butyl(methyl)silyl]oxy-bis[hydroxy(dimethyl)silyl]-methylsilane |
| SMILES | CCCC[SiH](C)O[Si](C)([Si](C)(C)O)[Si](C)(C)O |
| InChI | InChI=1S/C10H30O3Si4/c1-8-9-10-14(2)13-17(7,15(3,4)11)16(5,6)12/h11-12,14H,8-10H2,1-7H3 |
| InChIKey | JROUREHWOFELBQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|