C10H19N4O+ — CID 123671048
(4-amino-2-oxopyrimidin-1-yl)-butyl-dimethylazanium (PubChem CID 123671048) has the molecular formula C10H19N4O+ and a molecular weight of 211.29 g/mol. Its IUPAC name is (4-amino-2-oxopyrimidin-1-yl)-butyl-dimethylazanium.
| Compound Name | (4-amino-2-oxopyrimidin-1-yl)-butyl-dimethylazanium |
|---|---|
| PubChem CID | 123671048 |
| Molecular Formula | C10H19N4O+ |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (4-amino-2-oxopyrimidin-1-yl)-butyl-dimethylazanium |
| SMILES | CCCC[N+](C)(C)n1ccc(N)nc1=O |
| InChI | InChI=1S/C10H18N4O/c1-4-5-8-14(2,3)13-7-6-9(11)12-10(13)15/h6-7H,4-5,8H2,1-3H3,(H-,11,12,15)/p+1 |
| InChIKey | UYBCCODJUIRAGD-UHFFFAOYSA-O |
| XLogP | 0.32 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|