C12H19N3O2 — CID 142510049
4-amino-1-[(1S)-1-pentoxyprop-2-enyl]pyrimidin-2-one (PubChem CID 142510049) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-amino-1-[(1S)-1-pentoxyprop-2-enyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(1S)-1-pentoxyprop-2-enyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 142510049 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 4-amino-1-[(1S)-1-pentoxyprop-2-enyl]pyrimidin-2-one |
| SMILES | C=C[C@H](OCCCCC)n1ccc(N)nc1=O |
| InChI | InChI=1S/C12H19N3O2/c1-3-5-6-9-17-11(4-2)15-8-7-10(13)14-12(15)16/h4,7-8,11H,2-3,5-6,9H2,1H3,(H2,13,14,16)/t11-/m0/s1 |
| InChIKey | ZIKMFPQJVFFYSC-NSHDSACASA-N |
| XLogP | 1.72 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|