C28H22O14 — CID 123675391
3-[2-(2,3-dicarboxyphenyl)-3,4-bis(2-hydroxyethoxycarbonyl)phenyl]phthalic acid (PubChem CID 123675391) has the molecular formula C28H22O14 and a molecular weight of 582.47 g/mol. Its IUPAC name is 3-[2-(2,3-dicarboxyphenyl)-3,4-bis(2-hydroxyethoxycarbonyl)phenyl]phthalic acid.
| Compound Name | 3-[2-(2,3-dicarboxyphenyl)-3,4-bis(2-hydroxyethoxycarbonyl)phenyl]phthalic acid |
|---|---|
| PubChem CID | 123675391 |
| Molecular Formula | C28H22O14 |
| Molecular Weight | 582.47 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | 3-[2-(2,3-dicarboxyphenyl)-3,4-bis(2-hydroxyethoxycarbonyl)phenyl]phthalic acid |
| SMILES | O=C(O)c1cccc(-c2ccc(C(=O)OCCO)c(C(=O)OCCO)c2-c2cccc(C(=O)O)c2C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C28H22O14/c29-9-11-41-27(39)18-8-7-14(13-3-1-5-16(23(31)32)20(13)25(35)36)19(22(18)28(40)42-12-10-30)15-4-2-6-17(24(33)34)21(15)26(37)38/h1-8,29-30H,9-12H2,(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | RMLHYGLZMSLOIP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 242.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |