C16H27NO2 — CID 123678431
3-methyl-N-(oxan-2-ylmethyl)nona-2,4-dienamide (PubChem CID 123678431) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 3-methyl-N-(oxan-2-ylmethyl)nona-2,4-dienamide.
| Compound Name | 3-methyl-N-(oxan-2-ylmethyl)nona-2,4-dienamide |
|---|---|
| PubChem CID | 123678431 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 3-methyl-N-(oxan-2-ylmethyl)nona-2,4-dienamide |
| SMILES | CCCCC=CC(C)=CC(=O)NCC1CCCCO1 |
| InChI | InChI=1S/C16H27NO2/c1-3-4-5-6-9-14(2)12-16(18)17-13-15-10-7-8-11-19-15/h6,9,12,15H,3-5,7-8,10-11,13H2,1-2H3,(H,17,18) |
| InChIKey | VOOGTXIUZNWIHQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|