About 7-ethyl-4,5-dihydroazocine-2-carbonitrile
7-ethyl-4,5-dihydroazocine-2-carbonitrile (PubChem CID 123680264) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 7-ethyl-4,5-dihydroazocine-2-carbonitrile.
Molecular Properties
| Compound Name | 7-ethyl-4,5-dihydroazocine-2-carbonitrile |
| PubChem CID | 123680264 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 7-ethyl-4,5-dihydroazocine-2-carbonitrile |
| SMILES | CCC1=CCCC=C(C#N)/N=C\1 |
| InChI | InChI=1S/C10H12N2/c1-2-9-5-3-4-6-10(7-11)12-8-9/h5-6,8H,2-4H2,1H3/b9-5?,10-6?,12-8- |
| InChIKey | ZZOIUZIAJLMFLH-QEWGPIITSA-N |
| XLogP | 2.59 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-ethyl-4,5-dihydroazocine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-4,5-dihydroazocine-2-carbonitrile?
The IUPAC name of 7-ethyl-4,5-dihydroazocine-2-carbonitrile (CID 123680264) is 7-ethyl-4,5-dihydroazocine-2-carbonitrile.
What is the SMILES notation for 7-ethyl-4,5-dihydroazocine-2-carbonitrile?
The canonical SMILES for 7-ethyl-4,5-dihydroazocine-2-carbonitrile is CCC1=CCCC=C(C#N)/N=C\1.
What is the InChIKey of 7-ethyl-4,5-dihydroazocine-2-carbonitrile?
The InChIKey is ZZOIUZIAJLMFLH-QEWGPIITSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-9-5-3-4-6-10(7-11)12-8-9/h5-6,8H,2-4H2,1H3/b9-5?,10-6?,12-8-.
What are the key properties of 7-ethyl-4,5-dihydroazocine-2-carbonitrile?
7-ethyl-4,5-dihydroazocine-2-carbonitrile has a molecular weight of 160.22 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-4,5-dihydroazocine-2-carbonitrile is sourced from PubChem (CID 123680264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).