C10H12N2 — CID 123680264
7-ethyl-4,5-dihydroazocine-2-carbonitrile (PubChem CID 123680264) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 7-ethyl-4,5-dihydroazocine-2-carbonitrile.
| Compound Name | 7-ethyl-4,5-dihydroazocine-2-carbonitrile |
|---|---|
| PubChem CID | 123680264 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 7-ethyl-4,5-dihydroazocine-2-carbonitrile |
| SMILES | CCC1=CCCC=C(C#N)/N=C\1 |
| InChI | InChI=1S/C10H12N2/c1-2-9-5-3-4-6-10(7-11)12-8-9/h5-6,8H,2-4H2,1H3/b9-5?,10-6?,12-8- |
| InChIKey | ZZOIUZIAJLMFLH-QEWGPIITSA-N |
| XLogP | 2.59 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |