C18H13FN2OS — CID 123680579
9-[4-(aminomethyl)phenyl]-6-fluorothieno[2,3-c]quinolin-8-ol (PubChem CID 123680579) has the molecular formula C18H13FN2OS and a molecular weight of 324.38 g/mol. Its IUPAC name is 9-[4-(aminomethyl)phenyl]-6-fluorothieno[2,3-c]quinolin-8-ol.
| Compound Name | 9-[4-(aminomethyl)phenyl]-6-fluorothieno[2,3-c]quinolin-8-ol |
|---|---|
| PubChem CID | 123680579 |
| Molecular Formula | C18H13FN2OS |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 9-[4-(aminomethyl)phenyl]-6-fluorothieno[2,3-c]quinolin-8-ol |
| SMILES | NCc1ccc(-c2c(O)cc(F)c3ncc4sccc4c23)cc1 |
| InChI | InChI=1S/C18H13FN2OS/c19-13-7-14(22)16(11-3-1-10(8-20)2-4-11)17-12-5-6-23-15(12)9-21-18(13)17/h1-7,9,22H,8,20H2 |
| InChIKey | IGMQYGFMIVBKKS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |