About 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol
9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol (PubChem CID 67449244) has the molecular formula C21H18F2N2OS
and a molecular weight of 384.45 g/mol. Its IUPAC name is 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol.
Molecular Properties
| Compound Name | 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol |
| PubChem CID | 67449244 |
| Molecular Formula | C21H18F2N2OS |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol |
| SMILES | CC(c1ccc(-c2c(O)c(F)c(F)c3ncc4sccc4c23)cc1)N(C)C |
| InChI | InChI=1S/C21H18F2N2OS/c1-11(25(2)3)12-4-6-13(7-5-12)16-17-14-8-9-27-15(14)10-24-20(17)18(22)19(23)21(16)26/h4-11,26H,1-3H3 |
| InChIKey | UALDZTYAQOTFPN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol?
The IUPAC name of 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol (CID 67449244) is 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol.
What is the SMILES notation for 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol?
The canonical SMILES for 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol is CC(c1ccc(-c2c(O)c(F)c(F)c3ncc4sccc4c23)cc1)N(C)C.
What is the InChIKey of 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol?
The InChIKey is UALDZTYAQOTFPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2N2OS/c1-11(25(2)3)12-4-6-13(7-5-12)16-17-14-8-9-27-15(14)10-24-20(17)18(22)19(23)21(16)26/h4-11,26H,1-3H3.
What are the key properties of 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol?
9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol has a molecular weight of 384.45 g/mol, XLogP of 5.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinolin-8-ol is sourced from PubChem (CID 67449244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).