C21H18F2N2O2S — CID 123194939
9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinoline-1,8-diol (PubChem CID 123194939) has the molecular formula C21H18F2N2O2S and a molecular weight of 400.45 g/mol. Its IUPAC name is 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinoline-1,8-diol.
| Compound Name | 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinoline-1,8-diol |
|---|---|
| PubChem CID | 123194939 |
| Molecular Formula | C21H18F2N2O2S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 9-[4-[1-(dimethylamino)ethyl]phenyl]-6,7-difluorothieno[2,3-c]quinoline-1,8-diol |
| SMILES | CC(c1ccc(-c2c(O)c(F)c(F)c3ncc4scc(O)c4c23)cc1)N(C)C |
| InChI | InChI=1S/C21H18F2N2O2S/c1-10(25(2)3)11-4-6-12(7-5-11)15-17-16-13(26)9-28-14(16)8-24-20(17)18(22)19(23)21(15)27/h4-10,26-27H,1-3H3 |
| InChIKey | FLXRDHMFWLRJFS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|