C30H30F3N3O4 — CID 123680773
2-ethylaniline;4-[4-oxo-1-[(2,4,6-trifluorophenyl)methyl]quinazolin-6-yl]oxycyclohexane-1-carboxylic acid (PubChem CID 123680773) has the molecular formula C30H30F3N3O4 and a molecular weight of 553.58 g/mol. Its IUPAC name is 2-ethylaniline;4-[4-oxo-1-[(2,4,6-trifluorophenyl)methyl]quinazolin-6-yl]oxycyclohexane-1-carboxylic acid.
| Compound Name | 2-ethylaniline;4-[4-oxo-1-[(2,4,6-trifluorophenyl)methyl]quinazolin-6-yl]oxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 123680773 |
| Molecular Formula | C30H30F3N3O4 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 2-ethylaniline;4-[4-oxo-1-[(2,4,6-trifluorophenyl)methyl]quinazolin-6-yl]oxycyclohexane-1-carboxylic acid |
| SMILES | CCc1ccccc1N.O=C(O)C1CCC(Oc2ccc3c(c2)c(=O)ncn3Cc2c(F)cc(F)cc2F)CC1 |
| InChI | InChI=1S/C22H19F3N2O4.C8H11N/c23-13-7-18(24)17(19(25)8-13)10-27-11-26-21(28)16-9-15(5-6-20(16)27)31-14-3-1-12(2-4-14)22(29)30;1-2-7-5-3-4-6-8(7)9/h5-9,11-12,14H,1-4,10H2,(H,29,30);3-6H,2,9H2,1H3 |
| InChIKey | ZHOCEQHNPIHHDN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|