C28H29ClN4O4 — CID 123681535
3-(6-amino-3-pyridinyl)-N-[2-[2-chloro-4-[3-methyl-4-(morpholine-4-carbonyl)phenyl]phenoxy]ethyl]prop-2-enamide (PubChem CID 123681535) has the molecular formula C28H29ClN4O4 and a molecular weight of 521.02 g/mol. Its IUPAC name is 3-(6-amino-3-pyridinyl)-N-[2-[2-chloro-4-[3-methyl-4-(morpholine-4-carbonyl)phenyl]phenoxy]ethyl]prop-2-enamide.
| Compound Name | 3-(6-amino-3-pyridinyl)-N-[2-[2-chloro-4-[3-methyl-4-(morpholine-4-carbonyl)phenyl]phenoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 123681535 |
| Molecular Formula | C28H29ClN4O4 |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 3-(6-amino-3-pyridinyl)-N-[2-[2-chloro-4-[3-methyl-4-(morpholine-4-carbonyl)phenyl]phenoxy]ethyl]prop-2-enamide |
| SMILES | Cc1cc(-c2ccc(OCCNC(=O)C=Cc3ccc(N)nc3)c(Cl)c2)ccc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C28H29ClN4O4/c1-19-16-21(4-6-23(19)28(35)33-11-14-36-15-12-33)22-5-7-25(24(29)17-22)37-13-10-31-27(34)9-3-20-2-8-26(30)32-18-20/h2-9,16-18H,10-15H2,1H3,(H2,30,32)(H,31,34) |
| InChIKey | CNIUUVNPWUDHCK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|