C11H16 — CID 123687137
4-ethyl-1,3-dimethylcyclohepta-1,3,5-triene (PubChem CID 123687137) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 4-ethyl-1,3-dimethylcyclohepta-1,3,5-triene.
| Compound Name | 4-ethyl-1,3-dimethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 123687137 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 4-ethyl-1,3-dimethylcyclohepta-1,3,5-triene |
| SMILES | CCC1=C(C)C=C(C)CC=C1 |
| InChI | InChI=1S/C11H16/c1-4-11-7-5-6-9(2)8-10(11)3/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | NXBJDXRBVGMPIS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |