C29H30FN5O2S — CID 123688975
5-[[2-[benzyl-[4-[2-(4-fluorophenyl)ethylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 123688975) has the molecular formula C29H30FN5O2S and a molecular weight of 531.66 g/mol. Its IUPAC name is 5-[[2-[benzyl-[4-[2-(4-fluorophenyl)ethylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[benzyl-[4-[2-(4-fluorophenyl)ethylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123688975 |
| Molecular Formula | C29H30FN5O2S |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 5-[[2-[benzyl-[4-[2-(4-fluorophenyl)ethylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N(Cc3ccccc3)C3CCC(NCCc4ccc(F)cc4)CC3)n2)S1 |
| InChI | InChI=1S/C29H30FN5O2S/c30-22-8-6-20(7-9-22)14-16-31-23-10-12-25(13-11-23)35(19-21-4-2-1-3-5-21)28-32-17-15-24(33-28)18-26-27(36)34-29(37)38-26/h1-9,15,17-18,23,25,31H,10-14,16,19H2,(H,34,36,37) |
| InChIKey | LAIINPMYJCJSQW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|