C28H27F2N5O2S — CID 123614488
5-[[2-[[4-[[2-(2,6-difluorophenyl)phenyl]methylamino]cyclohexyl]-methylamino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 123614488) has the molecular formula C28H27F2N5O2S and a molecular weight of 535.62 g/mol. Its IUPAC name is 5-[[2-[[4-[[2-(2,6-difluorophenyl)phenyl]methylamino]cyclohexyl]-methylamino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[[4-[[2-(2,6-difluorophenyl)phenyl]methylamino]cyclohexyl]-methylamino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123614488 |
| Molecular Formula | C28H27F2N5O2S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 5-[[2-[[4-[[2-(2,6-difluorophenyl)phenyl]methylamino]cyclohexyl]-methylamino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(c1nccc(C=C2SC(=O)NC2=O)n1)C1CCC(NCc2ccccc2-c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C28H27F2N5O2S/c1-35(27-31-14-13-19(33-27)15-24-26(36)34-28(37)38-24)20-11-9-18(10-12-20)32-16-17-5-2-3-6-21(17)25-22(29)7-4-8-23(25)30/h2-8,13-15,18,20,32H,9-12,16H2,1H3,(H,34,36,37) |
| InChIKey | YSFIWBAUJSUBGE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|