C28H26F3N5O2S — CID 147846771
(5Z)-5-[[2-[[4-[[2-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methylamino]cyclohexyl]methyl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 147846771) has the molecular formula C28H26F3N5O2S and a molecular weight of 553.61 g/mol. Its IUPAC name is (5Z)-5-[[2-[[4-[[2-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methylamino]cyclohexyl]methyl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[[4-[[2-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methylamino]cyclohexyl]methyl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 147846771 |
| Molecular Formula | C28H26F3N5O2S |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | (5Z)-5-[[2-[[4-[[2-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methylamino]cyclohexyl]methyl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccnc(CC3CCC(NCc4cccnc4-c4ccc(C(F)(F)F)cc4)CC3)n2)S1 |
| InChI | InChI=1S/C28H26F3N5O2S/c29-28(30,31)20-7-5-18(6-8-20)25-19(2-1-12-33-25)16-34-21-9-3-17(4-10-21)14-24-32-13-11-22(35-24)15-23-26(37)36-27(38)39-23/h1-2,5-8,11-13,15,17,21,34H,3-4,9-10,14,16H2,(H,36,37,38)/b23-15- |
| InChIKey | HUAUKRKDOGNXQW-HAHDFKILSA-N |
| XLogP | 5.77 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|