C27H28N4O2S2 — CID 157454776
(5Z)-5-[[2-[[4-[[2-(5-methylthiophen-2-yl)-3-pyridinyl]methylamino]cyclohexyl]methyl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione (PubChem CID 157454776) has the molecular formula C27H28N4O2S2 and a molecular weight of 504.68 g/mol. Its IUPAC name is (5Z)-5-[[2-[[4-[[2-(5-methylthiophen-2-yl)-3-pyridinyl]methylamino]cyclohexyl]methyl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione.
| Compound Name | (5Z)-5-[[2-[[4-[[2-(5-methylthiophen-2-yl)-3-pyridinyl]methylamino]cyclohexyl]methyl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
|---|---|
| PubChem CID | 157454776 |
| Molecular Formula | C27H28N4O2S2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (5Z)-5-[[2-[[4-[[2-(5-methylthiophen-2-yl)-3-pyridinyl]methylamino]cyclohexyl]methyl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
| SMILES | Cc1ccc(-c2ncccc2CNC2CCC(Cc3nccc(/C=C4\SC(=O)CC4=O)n3)CC2)s1 |
| InChI | InChI=1S/C27H28N4O2S2/c1-17-4-9-23(34-17)27-19(3-2-11-29-27)16-30-20-7-5-18(6-8-20)13-25-28-12-10-21(31-25)14-24-22(32)15-26(33)35-24/h2-4,9-12,14,18,20,30H,5-8,13,15-16H2,1H3/b24-14- |
| InChIKey | WXTJNNRQUXSFPS-OYKKKHCWSA-N |
| XLogP | 5.37 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|