C25H23N5O3S — CID 147032128
N-[4-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]methyl]cyclohexyl]quinoline-8-carboxamide (PubChem CID 147032128) has the molecular formula C25H23N5O3S and a molecular weight of 473.56 g/mol. Its IUPAC name is N-[4-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]methyl]cyclohexyl]quinoline-8-carboxamide.
| Compound Name | N-[4-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]methyl]cyclohexyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 147032128 |
| Molecular Formula | C25H23N5O3S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | N-[4-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]methyl]cyclohexyl]quinoline-8-carboxamide |
| SMILES | O=C1NC(=O)/C(=C/c2ccnc(CC3CCC(NC(=O)c4cccc5cccnc45)CC3)n2)S1 |
| InChI | InChI=1S/C25H23N5O3S/c31-23(19-5-1-3-16-4-2-11-27-22(16)19)29-17-8-6-15(7-9-17)13-21-26-12-10-18(28-21)14-20-24(32)30-25(33)34-20/h1-5,10-12,14-15,17H,6-9,13H2,(H,29,31)(H,30,32,33)/b20-14- |
| InChIKey | AXUNNOQPTJRBEA-ZHZULCJRSA-N |
| XLogP | 3.88 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|