C15H14N4O3 — CID 162466167
N-(5-amino-2,6-dioxopiperidin-3-yl)quinoline-8-carboxamide (PubChem CID 162466167) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is N-(5-amino-2,6-dioxopiperidin-3-yl)quinoline-8-carboxamide.
| Compound Name | N-(5-amino-2,6-dioxopiperidin-3-yl)quinoline-8-carboxamide |
|---|---|
| PubChem CID | 162466167 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(5-amino-2,6-dioxopiperidin-3-yl)quinoline-8-carboxamide |
| SMILES | NC1CC(NC(=O)c2cccc3cccnc23)C(=O)NC1=O |
| InChI | InChI=1S/C15H14N4O3/c16-10-7-11(15(22)19-14(10)21)18-13(20)9-5-1-3-8-4-2-6-17-12(8)9/h1-6,10-11H,7,16H2,(H,18,20)(H,19,21,22) |
| InChIKey | JDCRKHNOMYTULW-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|