C23H26N4O3S — CID 160834565
(5Z)-5-[[2-[[4-[(4-methoxy-3-pyridinyl)methylamino]cyclohexyl]methyl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione (PubChem CID 160834565) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is (5Z)-5-[[2-[[4-[(4-methoxy-3-pyridinyl)methylamino]cyclohexyl]methyl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione.
| Compound Name | (5Z)-5-[[2-[[4-[(4-methoxy-3-pyridinyl)methylamino]cyclohexyl]methyl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
|---|---|
| PubChem CID | 160834565 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (5Z)-5-[[2-[[4-[(4-methoxy-3-pyridinyl)methylamino]cyclohexyl]methyl]pyrimidin-4-yl]methylidene]thiolane-2,4-dione |
| SMILES | COc1ccncc1CNC1CCC(Cc2nccc(/C=C3\SC(=O)CC3=O)n2)CC1 |
| InChI | InChI=1S/C23H26N4O3S/c1-30-20-7-8-24-13-16(20)14-26-17-4-2-15(3-5-17)10-22-25-9-6-18(27-22)11-21-19(28)12-23(29)31-21/h6-9,11,13,15,17,26H,2-5,10,12,14H2,1H3/b21-11- |
| InChIKey | CXJVLSDJPDOYRW-NHDPSOOVSA-N |
| XLogP | 3.34 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|