C21H20N4O2S2 — CID 123689028
2-(1,3-benzothiazol-5-yl)-6-piperidin-1-ylsulfonylquinolin-4-amine (PubChem CID 123689028) has the molecular formula C21H20N4O2S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-5-yl)-6-piperidin-1-ylsulfonylquinolin-4-amine.
| Compound Name | 2-(1,3-benzothiazol-5-yl)-6-piperidin-1-ylsulfonylquinolin-4-amine |
|---|---|
| PubChem CID | 123689028 |
| Molecular Formula | C21H20N4O2S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-(1,3-benzothiazol-5-yl)-6-piperidin-1-ylsulfonylquinolin-4-amine |
| SMILES | Nc1cc(-c2ccc3scnc3c2)nc2ccc(S(=O)(=O)N3CCCCC3)cc12 |
| InChI | InChI=1S/C21H20N4O2S2/c22-17-12-19(14-4-7-21-20(10-14)23-13-28-21)24-18-6-5-15(11-16(17)18)29(26,27)25-8-2-1-3-9-25/h4-7,10-13H,1-3,8-9H2,(H2,22,24) |
| InChIKey | NURQEJKIZYJDKX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |