C10H15N3O3S — CID 123691642
3-prop-2-enoyl-5-(3-sulfanylpropanoyl)-1,3,5-triazinane-1-carbaldehyde (PubChem CID 123691642) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 3-prop-2-enoyl-5-(3-sulfanylpropanoyl)-1,3,5-triazinane-1-carbaldehyde.
| Compound Name | 3-prop-2-enoyl-5-(3-sulfanylpropanoyl)-1,3,5-triazinane-1-carbaldehyde |
|---|---|
| PubChem CID | 123691642 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-prop-2-enoyl-5-(3-sulfanylpropanoyl)-1,3,5-triazinane-1-carbaldehyde |
| SMILES | C=CC(=O)N1CN(C=O)CN(C(=O)CCS)C1 |
| InChI | InChI=1S/C10H15N3O3S/c1-2-9(15)12-5-11(8-14)6-13(7-12)10(16)3-4-17/h2,8,17H,1,3-7H2 |
| InChIKey | ZRAKPMLLLIZEMI-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|