About 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone
1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone (PubChem CID 172877929) has the molecular formula C9H15N3O3S3
and a molecular weight of 309.44 g/mol. Its IUPAC name is 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone.
Molecular Properties
| Compound Name | 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone |
| PubChem CID | 172877929 |
| Molecular Formula | C9H15N3O3S3 |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone |
| SMILES | O=C(CS)N1CN(C(=O)CS)CN(C(=O)CS)C1 |
| InChI | InChI=1S/C9H15N3O3S3/c13-7(1-16)10-4-11(8(14)2-17)6-12(5-10)9(15)3-18/h16-18H,1-6H2 |
| InChIKey | GGRNFQFCCXCJJV-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone?
The IUPAC name of 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone (CID 172877929) is 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone.
What is the SMILES notation for 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone?
The canonical SMILES for 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone is O=C(CS)N1CN(C(=O)CS)CN(C(=O)CS)C1.
What is the InChIKey of 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone?
The InChIKey is GGRNFQFCCXCJJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3S3/c13-7(1-16)10-4-11(8(14)2-17)6-12(5-10)9(15)3-18/h16-18H,1-6H2.
What are the key properties of 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone?
1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone has a molecular weight of 309.44 g/mol, XLogP of -0.85, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(2-sulfanylacetyl)-1,3,5-triazinan-1-yl]-2-sulfanylethanone is sourced from PubChem (CID 172877929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).