C12H21N3O3S3 — CID 72716059
1-[3,5-bis(3-sulfanylpropanoyl)-1,3,5-triazinan-1-yl]-3-sulfanylpropan-1-one (PubChem CID 72716059) has the molecular formula C12H21N3O3S3 and a molecular weight of 351.52 g/mol. Its IUPAC name is 1-[3,5-bis(3-sulfanylpropanoyl)-1,3,5-triazinan-1-yl]-3-sulfanylpropan-1-one.
| Compound Name | 1-[3,5-bis(3-sulfanylpropanoyl)-1,3,5-triazinan-1-yl]-3-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 72716059 |
| Molecular Formula | C12H21N3O3S3 |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1-[3,5-bis(3-sulfanylpropanoyl)-1,3,5-triazinan-1-yl]-3-sulfanylpropan-1-one |
| SMILES | O=C(CCS)N1CN(C(=O)CCS)CN(C(=O)CCS)C1 |
| InChI | InChI=1S/C12H21N3O3S3/c16-10(1-4-19)13-7-14(11(17)2-5-20)9-15(8-13)12(18)3-6-21/h19-21H,1-9H2 |
| InChIKey | MCZUOUSQAMYRMN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|