C8H18N4S — CID 123691769
4-methyl-N'-(1-sulfanylethyl)piperazine-1-carboximidamide (PubChem CID 123691769) has the molecular formula C8H18N4S and a molecular weight of 202.33 g/mol. Its IUPAC name is 4-methyl-N'-(1-sulfanylethyl)piperazine-1-carboximidamide.
| Compound Name | 4-methyl-N'-(1-sulfanylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 123691769 |
| Molecular Formula | C8H18N4S |
| Molecular Weight | 202.33 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 4-methyl-N'-(1-sulfanylethyl)piperazine-1-carboximidamide |
| SMILES | CC(S)N=C(N)N1CCN(C)CC1 |
| InChI | InChI=1S/C8H18N4S/c1-7(13)10-8(9)12-5-3-11(2)4-6-12/h7,13H,3-6H2,1-2H3,(H2,9,10) |
| InChIKey | TZPACQCEKDUPLE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.33 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|