C11H23N5 — CID 172938497
N'-[(E)-2,2-dimethylpropylideneamino]-4-methylpiperazine-1-carboximidamide (PubChem CID 172938497) has the molecular formula C11H23N5 and a molecular weight of 225.34 g/mol. Its IUPAC name is N'-[(E)-2,2-dimethylpropylideneamino]-4-methylpiperazine-1-carboximidamide.
| Compound Name | N'-[(E)-2,2-dimethylpropylideneamino]-4-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 172938497 |
| Molecular Formula | C11H23N5 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.20 |
| IUPAC Name | N'-[(E)-2,2-dimethylpropylideneamino]-4-methylpiperazine-1-carboximidamide |
| SMILES | CN1CCN(C(N)=N/N=C/C(C)(C)C)CC1 |
| InChI | InChI=1S/C11H23N5/c1-11(2,3)9-13-14-10(12)16-7-5-15(4)6-8-16/h9H,5-8H2,1-4H3,(H2,12,14)/b13-9+ |
| InChIKey | VRJXZHWQQMPOJR-UKTHLTGXSA-N |
| XLogP | 0.58 |
| TPSA | 57.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|