C16H21N3O — CID 123692177
4-cyano-N-methyl-4-(2-phenylethyl)piperidine-1-carboxamide (PubChem CID 123692177) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-cyano-N-methyl-4-(2-phenylethyl)piperidine-1-carboxamide.
| Compound Name | 4-cyano-N-methyl-4-(2-phenylethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 123692177 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-cyano-N-methyl-4-(2-phenylethyl)piperidine-1-carboxamide |
| SMILES | CNC(=O)N1CCC(C#N)(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C16H21N3O/c1-18-15(20)19-11-9-16(13-17,10-12-19)8-7-14-5-3-2-4-6-14/h2-6H,7-12H2,1H3,(H,18,20) |
| InChIKey | UYIGMAANJYRIJS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |