C12H5ClF3N3O3 — CID 123692838
5-chloro-2-hydroxy-N-[5-isocyano-2-(trifluoromethyl)-1,3-oxazol-4-yl]benzamide (PubChem CID 123692838) has the molecular formula C12H5ClF3N3O3 and a molecular weight of 331.64 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-[5-isocyano-2-(trifluoromethyl)-1,3-oxazol-4-yl]benzamide.
| Compound Name | 5-chloro-2-hydroxy-N-[5-isocyano-2-(trifluoromethyl)-1,3-oxazol-4-yl]benzamide |
|---|---|
| PubChem CID | 123692838 |
| Molecular Formula | C12H5ClF3N3O3 |
| Molecular Weight | 331.64 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 5-chloro-2-hydroxy-N-[5-isocyano-2-(trifluoromethyl)-1,3-oxazol-4-yl]benzamide |
| SMILES | [C-]#[N+]c1oc(C(F)(F)F)nc1NC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C12H5ClF3N3O3/c1-17-10-8(19-11(22-10)12(14,15)16)18-9(21)6-4-5(13)2-3-7(6)20/h2-4,20H,(H,18,21) |
| InChIKey | VWSAPLJHXMUZPZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|