C13H24O5 — CID 123696213
(3-hydroxy-2-methylpentan-2-yl) 3-(2,2-dimethylpropyl)dioxirane-3-carboxylate (PubChem CID 123696213) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is (3-hydroxy-2-methylpentan-2-yl) 3-(2,2-dimethylpropyl)dioxirane-3-carboxylate.
| Compound Name | (3-hydroxy-2-methylpentan-2-yl) 3-(2,2-dimethylpropyl)dioxirane-3-carboxylate |
|---|---|
| PubChem CID | 123696213 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (3-hydroxy-2-methylpentan-2-yl) 3-(2,2-dimethylpropyl)dioxirane-3-carboxylate |
| SMILES | CCC(O)C(C)(C)OC(=O)C1(CC(C)(C)C)OO1 |
| InChI | InChI=1S/C13H24O5/c1-7-9(14)12(5,6)16-10(15)13(17-18-13)8-11(2,3)4/h9,14H,7-8H2,1-6H3 |
| InChIKey | YANHKKOFDJOUEW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|