C30H29N3O2 — CID 123698048
N-[[2-[2-[2-[4-(dimethylamino)phenyl]ethenyl]phenyl]phenyl]methyl]-6-methoxypyridine-3-carboxamide (PubChem CID 123698048) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[[2-[2-[2-[4-(dimethylamino)phenyl]ethenyl]phenyl]phenyl]methyl]-6-methoxypyridine-3-carboxamide.
| Compound Name | N-[[2-[2-[2-[4-(dimethylamino)phenyl]ethenyl]phenyl]phenyl]methyl]-6-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 123698048 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | N-[[2-[2-[2-[4-(dimethylamino)phenyl]ethenyl]phenyl]phenyl]methyl]-6-methoxypyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)NCc2ccccc2-c2ccccc2C=Cc2ccc(N(C)C)cc2)cn1 |
| InChI | InChI=1S/C30H29N3O2/c1-33(2)26-17-13-22(14-18-26)12-15-23-8-4-6-10-27(23)28-11-7-5-9-24(28)20-32-30(34)25-16-19-29(35-3)31-21-25/h4-19,21H,20H2,1-3H3,(H,32,34) |
| InChIKey | KOZRJVCMVCQJTA-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|